C14H14Cl2N3O3+ — CID 7241387
(3,4-dichlorophenyl)methyl-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium (PubChem CID 7241387) has the molecular formula C14H14Cl2N3O3+ and a molecular weight of 343.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium.
| Compound Name | (3,4-dichlorophenyl)methyl-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
|---|---|
| PubChem CID | 7241387 |
| Molecular Formula | C14H14Cl2N3O3+ |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
| SMILES | CN1C(=O)C(/C=[NH+]/Cc2ccc(Cl)c(Cl)c2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H13Cl2N3O3/c1-18-12(20)9(13(21)19(2)14(18)22)7-17-6-8-3-4-10(15)11(16)5-8/h3-5,7,9H,6H2,1-2H3/p+1/b17-7+ |
| InChIKey | VAKFPEQBYBADLQ-REZTVBANSA-O |
| XLogP | 0.31 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|