C16H13Cl2NO2 — CID 23411104
4-[(3,4-dichlorophenyl)methyl]-2-methyl-1,4-benzoxazin-3-one (PubChem CID 23411104) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23411104 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-2-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccccc2N(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H13Cl2NO2/c1-10-16(20)19(14-4-2-3-5-15(14)21-10)9-11-6-7-12(17)13(18)8-11/h2-8,10H,9H2,1H3 |
| InChIKey | RCQQMXZTMSORPG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |