C15H12Cl2N2O2 — CID 106994088
4-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-1,4-benzoxazin-3-one (PubChem CID 106994088) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 106994088 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccccc2N(Cc2ccc(Cl)nc2Cl)C1=O |
| InChI | InChI=1S/C15H12Cl2N2O2/c1-9-15(20)19(11-4-2-3-5-12(11)21-9)8-10-6-7-13(16)18-14(10)17/h2-7,9H,8H2,1H3 |
| InChIKey | YVIZQLSQJOCIOB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|