C14H19NO2 — CID 117007341
2-methyl-4-pentyl-1,4-benzoxazin-3-one (PubChem CID 117007341) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-methyl-4-pentyl-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-4-pentyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 117007341 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-methyl-4-pentyl-1,4-benzoxazin-3-one |
| SMILES | CCCCCN1C(=O)C(C)Oc2ccccc21 |
| InChI | InChI=1S/C14H19NO2/c1-3-4-7-10-15-12-8-5-6-9-13(12)17-11(2)14(15)16/h5-6,8-9,11H,3-4,7,10H2,1-2H3 |
| InChIKey | DTKZIUNKNQTHFG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|