C17H25NO2 — CID 71156433
4-hexyl-2-propyl-1,4-benzoxazin-3-one (PubChem CID 71156433) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-hexyl-2-propyl-1,4-benzoxazin-3-one.
| Compound Name | 4-hexyl-2-propyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 71156433 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-hexyl-2-propyl-1,4-benzoxazin-3-one |
| SMILES | CCCCCCN1C(=O)C(CCC)Oc2ccccc21 |
| InChI | InChI=1S/C17H25NO2/c1-3-5-6-9-13-18-14-11-7-8-12-15(14)20-16(10-4-2)17(18)19/h7-8,11-12,16H,3-6,9-10,13H2,1-2H3 |
| InChIKey | XQFVSNWEVPIVHI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|