About ethane;10-hexylphenoxazine
ethane;10-hexylphenoxazine (PubChem CID 143421722) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is ethane;10-hexylphenoxazine.
Molecular Properties
| Compound Name | ethane;10-hexylphenoxazine |
| PubChem CID | 143421722 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | ethane;10-hexylphenoxazine |
| SMILES | CC.CCCCCCN1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C18H21NO.C2H6/c1-2-3-4-9-14-19-15-10-5-7-12-17(15)20-18-13-8-6-11-16(18)19;1-2/h5-8,10-13H,2-4,9,14H2,1H3;1-2H3 |
| InChIKey | IHXKFVHXRHJBBX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;10-hexylphenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;10-hexylphenoxazine?
The IUPAC name of ethane;10-hexylphenoxazine (CID 143421722) is ethane;10-hexylphenoxazine.
What is the SMILES notation for ethane;10-hexylphenoxazine?
The canonical SMILES for ethane;10-hexylphenoxazine is CC.CCCCCCN1c2ccccc2Oc2ccccc21.
What is the InChIKey of ethane;10-hexylphenoxazine?
The InChIKey is IHXKFVHXRHJBBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO.C2H6/c1-2-3-4-9-14-19-15-10-5-7-12-17(15)20-18-13-8-6-11-16(18)19;1-2/h5-8,10-13H,2-4,9,14H2,1H3;1-2H3.
What are the key properties of ethane;10-hexylphenoxazine?
ethane;10-hexylphenoxazine has a molecular weight of 297.44 g/mol, XLogP of 6.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;10-hexylphenoxazine is sourced from PubChem (CID 143421722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).