C18H21NO — CID 67833810
5-pentyl-6H-benzo[b][1,4]benzoxazepine (PubChem CID 67833810) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-pentyl-6H-benzo[b][1,4]benzoxazepine.
| Compound Name | 5-pentyl-6H-benzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 67833810 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-pentyl-6H-benzo[b][1,4]benzoxazepine |
| SMILES | CCCCCN1Cc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C18H21NO/c1-2-3-8-13-19-14-15-9-4-6-11-17(15)20-18-12-7-5-10-16(18)19/h4-7,9-12H,2-3,8,13-14H2,1H3 |
| InChIKey | IDZDBLFJWHVCGH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|