C20H26Cl2N2O — CID 16760284
4-(2-chlorophenoxazin-10-yl)-N,N-diethylbutan-1-amine;hydrochloride (PubChem CID 16760284) has the molecular formula C20H26Cl2N2O and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-(2-chlorophenoxazin-10-yl)-N,N-diethylbutan-1-amine;hydrochloride.
| Compound Name | 4-(2-chlorophenoxazin-10-yl)-N,N-diethylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 16760284 |
| Molecular Formula | C20H26Cl2N2O |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-(2-chlorophenoxazin-10-yl)-N,N-diethylbutan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCCN1c2ccccc2Oc2ccc(Cl)cc21.Cl |
| InChI | InChI=1S/C20H25ClN2O.ClH/c1-3-22(4-2)13-7-8-14-23-17-9-5-6-10-19(17)24-20-12-11-16(21)15-18(20)23;/h5-6,9-12,15H,3-4,7-8,13-14H2,1-2H3;1H |
| InChIKey | SVKSJUIYYCQZEC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|