C30H41N3O2S — CID 143252781
N,N-diethyl-10-[3-[propyl(thiophen-2-ylmethyl)amino]propyl]phenoxazine-3-carboxamide;ethane (PubChem CID 143252781) has the molecular formula C30H41N3O2S and a molecular weight of 507.74 g/mol. Its IUPAC name is N,N-diethyl-10-[3-[propyl(thiophen-2-ylmethyl)amino]propyl]phenoxazine-3-carboxamide;ethane.
| Compound Name | N,N-diethyl-10-[3-[propyl(thiophen-2-ylmethyl)amino]propyl]phenoxazine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143252781 |
| Molecular Formula | C30H41N3O2S |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | N,N-diethyl-10-[3-[propyl(thiophen-2-ylmethyl)amino]propyl]phenoxazine-3-carboxamide;ethane |
| SMILES | CC.CCCN(CCCN1c2ccccc2Oc2cc(C(=O)N(CC)CC)ccc21)Cc1cccs1 |
| InChI | InChI=1S/C28H35N3O2S.C2H6/c1-4-16-29(21-23-11-9-19-34-23)17-10-18-31-24-12-7-8-13-26(24)33-27-20-22(14-15-25(27)31)28(32)30(5-2)6-3;1-2/h7-9,11-15,19-20H,4-6,10,16-18,21H2,1-3H3;1-2H3 |
| InChIKey | DHICZVJFKMUZOV-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|