C18H19Br2NO — CID 86076992
3,7-dibromo-10-hexylphenoxazine (PubChem CID 86076992) has the molecular formula C18H19Br2NO and a molecular weight of 425.16 g/mol. Its IUPAC name is 3,7-dibromo-10-hexylphenoxazine.
| Compound Name | 3,7-dibromo-10-hexylphenoxazine |
|---|---|
| PubChem CID | 86076992 |
| Molecular Formula | C18H19Br2NO |
| Molecular Weight | 425.16 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 3,7-dibromo-10-hexylphenoxazine |
| SMILES | CCCCCCN1c2ccc(Br)cc2Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C18H19Br2NO/c1-2-3-4-5-10-21-15-8-6-13(19)11-17(15)22-18-12-14(20)7-9-16(18)21/h6-9,11-12H,2-5,10H2,1H3 |
| InChIKey | VSSKHEPXFNXODN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.16 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|