C23H22BrNO2S — CID 142714304
5-(7-bromo-10-hexylphenoxazin-3-yl)thiophene-2-carbaldehyde (PubChem CID 142714304) has the molecular formula C23H22BrNO2S and a molecular weight of 456.41 g/mol. Its IUPAC name is 5-(7-bromo-10-hexylphenoxazin-3-yl)thiophene-2-carbaldehyde.
| Compound Name | 5-(7-bromo-10-hexylphenoxazin-3-yl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 142714304 |
| Molecular Formula | C23H22BrNO2S |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 5-(7-bromo-10-hexylphenoxazin-3-yl)thiophene-2-carbaldehyde |
| SMILES | CCCCCCN1c2ccc(Br)cc2Oc2cc(-c3ccc(C=O)s3)ccc21 |
| InChI | InChI=1S/C23H22BrNO2S/c1-2-3-4-5-12-25-19-9-6-16(23-11-8-18(15-26)28-23)13-21(19)27-22-14-17(24)7-10-20(22)25/h6-11,13-15H,2-5,12H2,1H3 |
| InChIKey | JZDMTFWVYZYFPK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|