C12H15NO2 — CID 140970605
(2R)-2,4-diethyl-1,4-benzoxazin-3-one (PubChem CID 140970605) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (2R)-2,4-diethyl-1,4-benzoxazin-3-one.
| Compound Name | (2R)-2,4-diethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 140970605 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2R)-2,4-diethyl-1,4-benzoxazin-3-one |
| SMILES | CC[C@H]1Oc2ccccc2N(CC)C1=O |
| InChI | InChI=1S/C12H15NO2/c1-3-10-12(14)13(4-2)9-7-5-6-8-11(9)15-10/h5-8,10H,3-4H2,1-2H3/t10-/m1/s1 |
| InChIKey | OWHHQZAWOPOWJE-SNVBAGLBSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |