C17H16FNO2 — CID 4278808
2-ethyl-4-[(4-fluorophenyl)methyl]-1,4-benzoxazin-3-one (PubChem CID 4278808) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-ethyl-4-[(4-fluorophenyl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-ethyl-4-[(4-fluorophenyl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 4278808 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-ethyl-4-[(4-fluorophenyl)methyl]-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2ccccc2N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H16FNO2/c1-2-15-17(20)19(11-12-7-9-13(18)10-8-12)14-5-3-4-6-16(14)21-15/h3-10,15H,2,11H2,1H3 |
| InChIKey | NADVCPVLZZBTNJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |