C18H19NO3 — CID 82338571
4-benzyl-2-ethyl-7-(hydroxymethyl)-1,4-benzoxazin-3-one (PubChem CID 82338571) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-benzyl-2-ethyl-7-(hydroxymethyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-benzyl-2-ethyl-7-(hydroxymethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82338571 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-benzyl-2-ethyl-7-(hydroxymethyl)-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2cc(CO)ccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H19NO3/c1-2-16-18(21)19(11-13-6-4-3-5-7-13)15-9-8-14(12-20)10-17(15)22-16/h3-10,16,20H,2,11-12H2,1H3 |
| InChIKey | KABYJDUBZARZQY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |