C13H13NO2 — CID 63657858
4-but-3-ynyl-2-methyl-1,4-benzoxazin-3-one (PubChem CID 63657858) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-but-3-ynyl-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-but-3-ynyl-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63657858 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-but-3-ynyl-2-methyl-1,4-benzoxazin-3-one |
| SMILES | C#CCCN1C(=O)C(C)Oc2ccccc21 |
| InChI | InChI=1S/C13H13NO2/c1-3-4-9-14-11-7-5-6-8-12(11)16-10(2)13(14)15/h1,5-8,10H,4,9H2,2H3 |
| InChIKey | IYESJSLFBKPVMO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|