C18H20N2O2 — CID 102008720
8-[6,6-dimethylhepta-2,4-diynyl(methyl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 102008720) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 8-[6,6-dimethylhepta-2,4-diynyl(methyl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[6,6-dimethylhepta-2,4-diynyl(methyl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 102008720 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 8-[6,6-dimethylhepta-2,4-diynyl(methyl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | CN(CC#CC#CC(C)(C)C)c1cccc2c1OCC(=O)N2 |
| InChI | InChI=1S/C18H20N2O2/c1-18(2,3)11-6-5-7-12-20(4)15-10-8-9-14-17(15)22-13-16(21)19-14/h8-10H,12-13H2,1-4H3,(H,19,21) |
| InChIKey | JXKYUXXRAJKNAS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|