C11H12Cl2O — CID 14181025
3-(3,4-dichlorophenyl)-2,2-dimethylpropanal (PubChem CID 14181025) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2,2-dimethylpropanal.
| Compound Name | 3-(3,4-dichlorophenyl)-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 14181025 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2O/c1-11(2,7-14)6-8-3-4-9(12)10(13)5-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | TZYPJTMSPWZEFW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|