C16H22O — CID 129031612
3-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2,2-dimethylpropanal (PubChem CID 129031612) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2,2-dimethylpropanal.
| Compound Name | 3-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 129031612 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cc1ccc2c(c1)C(C)(C)CC2 |
| InChI | InChI=1S/C16H22O/c1-15(2,11-17)10-12-5-6-13-7-8-16(3,4)14(13)9-12/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | OSVYYBVHKXRBAJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|