C15H20 — CID 173288618
3,3-dimethyl-5-(2-methylprop-2-enyl)-1,2-dihydroindene (PubChem CID 173288618) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,3-dimethyl-5-(2-methylprop-2-enyl)-1,2-dihydroindene.
| Compound Name | 3,3-dimethyl-5-(2-methylprop-2-enyl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 173288618 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3,3-dimethyl-5-(2-methylprop-2-enyl)-1,2-dihydroindene |
| SMILES | C=C(C)Cc1ccc2c(c1)C(C)(C)CC2 |
| InChI | InChI=1S/C15H20/c1-11(2)9-12-5-6-13-7-8-15(3,4)14(13)10-12/h5-6,10H,1,7-9H2,2-4H3 |
| InChIKey | GULBMFGVOKCMAH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|