C14H18O — CID 139609254
2,4-bis(2-methylprop-2-enyl)phenol (PubChem CID 139609254) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,4-bis(2-methylprop-2-enyl)phenol.
| Compound Name | 2,4-bis(2-methylprop-2-enyl)phenol |
|---|---|
| PubChem CID | 139609254 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2,4-bis(2-methylprop-2-enyl)phenol |
| SMILES | C=C(C)Cc1ccc(O)c(CC(=C)C)c1 |
| InChI | InChI=1S/C14H18O/c1-10(2)7-12-5-6-14(15)13(9-12)8-11(3)4/h5-6,9,15H,1,3,7-8H2,2,4H3 |
| InChIKey | DLRNOPFWXUCECV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|