C21H22O3 — CID 139631724
bis[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]methanone (PubChem CID 139631724) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is bis[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]methanone.
| Compound Name | bis[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]methanone |
|---|---|
| PubChem CID | 139631724 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | bis[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]methanone |
| SMILES | C=C(C)Cc1cc(C(=O)c2ccc(O)c(CC(=C)C)c2)ccc1O |
| InChI | InChI=1S/C21H22O3/c1-13(2)9-17-11-15(5-7-19(17)22)21(24)16-6-8-20(23)18(12-16)10-14(3)4/h5-8,11-12,22-23H,1,3,9-10H2,2,4H3 |
| InChIKey | XNQOJALHUPHDEG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|