C16H14O4 — CID 14089152
3-(5-benzoyl-2-hydroxyphenyl)propanoic acid (PubChem CID 14089152) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3-(5-benzoyl-2-hydroxyphenyl)propanoic acid.
| Compound Name | 3-(5-benzoyl-2-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 14089152 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-(5-benzoyl-2-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)CCc1cc(C(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C16H14O4/c17-14-8-6-13(10-12(14)7-9-15(18)19)16(20)11-4-2-1-3-5-11/h1-6,8,10,17H,7,9H2,(H,18,19) |
| InChIKey | VLGKIXSYCYDAKI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |