C25H29BrO5 — CID 19921954
3-[2-(6-bromohexyl)-5-(3-ethoxycarbonylbenzoyl)phenyl]propanoic acid (PubChem CID 19921954) has the molecular formula C25H29BrO5 and a molecular weight of 489.41 g/mol. Its IUPAC name is 3-[2-(6-bromohexyl)-5-(3-ethoxycarbonylbenzoyl)phenyl]propanoic acid.
| Compound Name | 3-[2-(6-bromohexyl)-5-(3-ethoxycarbonylbenzoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19921954 |
| Molecular Formula | C25H29BrO5 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-[2-(6-bromohexyl)-5-(3-ethoxycarbonylbenzoyl)phenyl]propanoic acid |
| SMILES | CCOC(=O)c1cccc(C(=O)c2ccc(CCCCCCBr)c(CCC(=O)O)c2)c1 |
| InChI | InChI=1S/C25H29BrO5/c1-2-31-25(30)22-10-7-9-20(17-22)24(29)21-12-11-18(8-5-3-4-6-15-26)19(16-21)13-14-23(27)28/h7,9-12,16-17H,2-6,8,13-15H2,1H3,(H,27,28) |
| InChIKey | MPRAPEAFJPIZGK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|