C22H24O6 — CID 14739655
ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-methoxybenzoyl]benzoate (PubChem CID 14739655) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-methoxybenzoyl]benzoate.
| Compound Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-methoxybenzoyl]benzoate |
|---|---|
| PubChem CID | 14739655 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-methoxybenzoyl]benzoate |
| SMILES | CCOC(=O)CCc1cc(C(=O)c2cccc(C(=O)OCC)c2)ccc1OC |
| InChI | InChI=1S/C22H24O6/c1-4-27-20(23)12-10-15-13-17(9-11-19(15)26-3)21(24)16-7-6-8-18(14-16)22(25)28-5-2/h6-9,11,13-14H,4-5,10,12H2,1-3H3 |
| InChIKey | KTVPOWCQDRZZKC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |