C32H34O7 — CID 54239591
3-[5-(3-ethoxycarbonylbenzoyl)-2-[6-(3-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 54239591) has the molecular formula C32H34O7 and a molecular weight of 530.62 g/mol. Its IUPAC name is 3-[5-(3-ethoxycarbonylbenzoyl)-2-[6-(3-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[5-(3-ethoxycarbonylbenzoyl)-2-[6-(3-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54239591 |
| Molecular Formula | C32H34O7 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 3-[5-(3-ethoxycarbonylbenzoyl)-2-[6-(3-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | CCOC(=O)c1cccc(C(=O)c2ccc(OCCCCC=Cc3cccc(OC)c3)c(CCC(=O)O)c2)c1 |
| InChI | InChI=1S/C32H34O7/c1-3-38-32(36)27-13-9-12-25(22-27)31(35)26-15-17-29(24(21-26)16-18-30(33)34)39-19-7-5-4-6-10-23-11-8-14-28(20-23)37-2/h6,8-15,17,20-22H,3-5,7,16,18-19H2,1-2H3,(H,33,34) |
| InChIKey | QPAWWILAPUEZHS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|