C32H34O7S — CID 19745155
3-[5-(3-ethoxycarbonylbenzoyl)-2-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 19745155) has the molecular formula C32H34O7S and a molecular weight of 562.68 g/mol. Its IUPAC name is 3-[5-(3-ethoxycarbonylbenzoyl)-2-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[5-(3-ethoxycarbonylbenzoyl)-2-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19745155 |
| Molecular Formula | C32H34O7S |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 3-[5-(3-ethoxycarbonylbenzoyl)-2-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | CCOC(=O)c1cccc(C(=O)c2ccc(OCCCC/C=C/c3ccc(S(C)=O)cc3)c(CCC(=O)O)c2)c1 |
| InChI | InChI=1S/C32H34O7S/c1-3-38-32(36)27-11-8-10-25(22-27)31(35)26-14-18-29(24(21-26)15-19-30(33)34)39-20-7-5-4-6-9-23-12-16-28(17-13-23)40(2)37/h6,8-14,16-18,21-22H,3-5,7,15,19-20H2,1-2H3,(H,33,34)/b9-6+ |
| InChIKey | NGIUNHNEEFEOFT-RMKNXTFCSA-N |
| XLogP | 6.11 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|