C27H32O6 — CID 67780010
ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-[(E)-6-hydroxyhex-1-enyl]benzoyl]benzoate (PubChem CID 67780010) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-[(E)-6-hydroxyhex-1-enyl]benzoyl]benzoate.
| Compound Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-[(E)-6-hydroxyhex-1-enyl]benzoyl]benzoate |
|---|---|
| PubChem CID | 67780010 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-4-[(E)-6-hydroxyhex-1-enyl]benzoyl]benzoate |
| SMILES | CCOC(=O)CCc1cc(C(=O)c2cccc(C(=O)OCC)c2)ccc1/C=C/CCCCO |
| InChI | InChI=1S/C27H32O6/c1-3-32-25(29)16-15-21-18-23(14-13-20(21)10-7-5-6-8-17-28)26(30)22-11-9-12-24(19-22)27(31)33-4-2/h7,9-14,18-19,28H,3-6,8,15-17H2,1-2H3/b10-7+ |
| InChIKey | HROKDTUYXYYWHQ-JXMROGBWSA-N |
| XLogP | 4.77 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|