C20H22O2S — CID 139631748
4-[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]sulfanyl-2-(2-methylprop-2-enyl)phenol (PubChem CID 139631748) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is 4-[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]sulfanyl-2-(2-methylprop-2-enyl)phenol.
| Compound Name | 4-[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]sulfanyl-2-(2-methylprop-2-enyl)phenol |
|---|---|
| PubChem CID | 139631748 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-[4-hydroxy-3-(2-methylprop-2-enyl)phenyl]sulfanyl-2-(2-methylprop-2-enyl)phenol |
| SMILES | C=C(C)Cc1cc(Sc2ccc(O)c(CC(=C)C)c2)ccc1O |
| InChI | InChI=1S/C20H22O2S/c1-13(2)9-15-11-17(5-7-19(15)21)23-18-6-8-20(22)16(12-18)10-14(3)4/h5-8,11-12,21-22H,1,3,9-10H2,2,4H3 |
| InChIKey | QPIHDNGOFWISHB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|