C15H18O — CID 129031614
1-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2-methylprop-2-en-1-one (PubChem CID 129031614) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2-methylprop-2-en-1-one.
| Compound Name | 1-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 129031614 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-(3,3-dimethyl-1,2-dihydroinden-5-yl)-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1ccc2c(c1)C(C)(C)CC2 |
| InChI | InChI=1S/C15H18O/c1-10(2)14(16)12-6-5-11-7-8-15(3,4)13(11)9-12/h5-6,9H,1,7-8H2,2-4H3 |
| InChIKey | ZBAWFQKAHLIJMV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|