C17H20N2 — CID 159470050
2-[2-(3,3-dimethyl-1,2-dihydroinden-5-yl)ethyl]pyrazine (PubChem CID 159470050) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[2-(3,3-dimethyl-1,2-dihydroinden-5-yl)ethyl]pyrazine.
| Compound Name | 2-[2-(3,3-dimethyl-1,2-dihydroinden-5-yl)ethyl]pyrazine |
|---|---|
| PubChem CID | 159470050 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-[2-(3,3-dimethyl-1,2-dihydroinden-5-yl)ethyl]pyrazine |
| SMILES | CC1(C)CCc2ccc(CCc3cnccn3)cc21 |
| InChI | InChI=1S/C17H20N2/c1-17(2)8-7-14-5-3-13(11-16(14)17)4-6-15-12-18-9-10-19-15/h3,5,9-12H,4,6-8H2,1-2H3 |
| InChIKey | IZFQJTUXOZAIMI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |