C11H15Cl2N — CID 62739590
3-(3,4-dichlorophenyl)-2,2-dimethylpropan-1-amine (PubChem CID 62739590) has the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2,2-dimethylpropan-1-amine.
| Compound Name | 3-(3,4-dichlorophenyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 62739590 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(CN)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N/c1-11(2,7-14)6-8-3-4-9(12)10(13)5-8/h3-5H,6-7,14H2,1-2H3 |
| InChIKey | SCIXZIYSSQCMEF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |