C15H18Cl2O4 — CID 103972592
diethyl 2-[(3,4-dichlorophenyl)methyl]-2-methylpropanedioate (PubChem CID 103972592) has the molecular formula C15H18Cl2O4 and a molecular weight of 333.21 g/mol. Its IUPAC name is diethyl 2-[(3,4-dichlorophenyl)methyl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[(3,4-dichlorophenyl)methyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 103972592 |
| Molecular Formula | C15H18Cl2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | diethyl 2-[(3,4-dichlorophenyl)methyl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(Cl)c(Cl)c1)C(=O)OCC |
| InChI | InChI=1S/C15H18Cl2O4/c1-4-20-13(18)15(3,14(19)21-5-2)9-10-6-7-11(16)12(17)8-10/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | OVXSSANTTGJMRL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|