About ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate
ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate (PubChem CID 154142826) has the molecular formula C19H15Cl4NO2
and a molecular weight of 431.15 g/mol. Its IUPAC name is ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate |
| PubChem CID | 154142826 |
| Molecular Formula | C19H15Cl4NO2 |
| Molecular Weight | 431.15 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate |
| SMILES | CCOC(=O)C(C#N)(Cc1ccc(Cl)c(Cl)c1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl4NO2/c1-2-26-18(25)19(11-24,9-12-3-5-14(20)16(22)7-12)10-13-4-6-15(21)17(23)8-13/h3-8H,2,9-10H2,1H3 |
| InChIKey | OGPORIQYBPIXJA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.15 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate?
The IUPAC name of ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate (CID 154142826) is ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate.
What is the SMILES notation for ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate?
The canonical SMILES for ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate is CCOC(=O)C(C#N)(Cc1ccc(Cl)c(Cl)c1)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate?
The InChIKey is OGPORIQYBPIXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl4NO2/c1-2-26-18(25)19(11-24,9-12-3-5-14(20)16(22)7-12)10-13-4-6-15(21)17(23)8-13/h3-8H,2,9-10H2,1H3.
What are the key properties of ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate?
ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate has a molecular weight of 431.15 g/mol, XLogP of 6.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-3-(3,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methyl]propanoate is sourced from PubChem (CID 154142826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).