C26H33NO2 — CID 44819689
methyl 3-(4-tert-butylphenyl)-2-[(4-tert-butylphenyl)methyl]-2-cyanopropanoate (PubChem CID 44819689) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is methyl 3-(4-tert-butylphenyl)-2-[(4-tert-butylphenyl)methyl]-2-cyanopropanoate.
| Compound Name | methyl 3-(4-tert-butylphenyl)-2-[(4-tert-butylphenyl)methyl]-2-cyanopropanoate |
|---|---|
| PubChem CID | 44819689 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | methyl 3-(4-tert-butylphenyl)-2-[(4-tert-butylphenyl)methyl]-2-cyanopropanoate |
| SMILES | COC(=O)C(C#N)(Cc1ccc(C(C)(C)C)cc1)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H33NO2/c1-24(2,3)21-12-8-19(9-13-21)16-26(18-27,23(28)29-7)17-20-10-14-22(15-11-20)25(4,5)6/h8-15H,16-17H2,1-7H3 |
| InChIKey | ZLUPMHNOKIDYSC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |