C22H20N2O4 — CID 170847975
dimethyl (2R,3R)-2,3-dicyano-2,3-bis(4-methylphenyl)butanedioate (PubChem CID 170847975) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-dicyano-2,3-bis(4-methylphenyl)butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-dicyano-2,3-bis(4-methylphenyl)butanedioate |
|---|---|
| PubChem CID | 170847975 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | dimethyl (2R,3R)-2,3-dicyano-2,3-bis(4-methylphenyl)butanedioate |
| SMILES | COC(=O)[C@](C#N)(c1ccc(C)cc1)[C@](C#N)(C(=O)OC)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-15-5-9-17(10-6-15)21(13-23,19(25)27-3)22(14-24,20(26)28-4)18-11-7-16(2)8-12-18/h5-12H,1-4H3/t21-,22-/m0/s1 |
| InChIKey | GUGPVHHIXBFQCH-VXKWHMMOSA-N |
| XLogP | 2.87 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |