C10H10Cl2O2 — CID 66039817
3-(3,4-dichlorophenyl)-2-hydroxy-2-methylpropanal (PubChem CID 66039817) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-hydroxy-2-methylpropanal.
| Compound Name | 3-(3,4-dichlorophenyl)-2-hydroxy-2-methylpropanal |
|---|---|
| PubChem CID | 66039817 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-hydroxy-2-methylpropanal |
| SMILES | CC(O)(C=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2O2/c1-10(14,6-13)5-7-2-3-8(11)9(12)4-7/h2-4,6,14H,5H2,1H3 |
| InChIKey | ILJJVYAOEQPUTR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|