C13H17ClO3S — CID 68837912
ethyl 2-[(4-chloro-3-hydroxyphenyl)methylsulfanyl]-2-methylpropanoate (PubChem CID 68837912) has the molecular formula C13H17ClO3S and a molecular weight of 288.80 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-3-hydroxyphenyl)methylsulfanyl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(4-chloro-3-hydroxyphenyl)methylsulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 68837912 |
| Molecular Formula | C13H17ClO3S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | ethyl 2-[(4-chloro-3-hydroxyphenyl)methylsulfanyl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)SCc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C13H17ClO3S/c1-4-17-12(16)13(2,3)18-8-9-5-6-10(14)11(15)7-9/h5-7,15H,4,8H2,1-3H3 |
| InChIKey | JLSBWLCDMQGJGJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |