C14H16Cl2O3S — CID 142636857
ethyl 2-[2-(2,4-dichlorophenyl)acetyl]sulfanyl-2-methylpropanoate (PubChem CID 142636857) has the molecular formula C14H16Cl2O3S and a molecular weight of 335.25 g/mol. Its IUPAC name is ethyl 2-[2-(2,4-dichlorophenyl)acetyl]sulfanyl-2-methylpropanoate.
| Compound Name | ethyl 2-[2-(2,4-dichlorophenyl)acetyl]sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 142636857 |
| Molecular Formula | C14H16Cl2O3S |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | ethyl 2-[2-(2,4-dichlorophenyl)acetyl]sulfanyl-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)SC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2O3S/c1-4-19-13(18)14(2,3)20-12(17)7-9-5-6-10(15)8-11(9)16/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | AOABUIXZPGAKCH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|