About S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate
S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate (PubChem CID 165360435) has the molecular formula C12H16ClNO2S
and a molecular weight of 273.78 g/mol. Its IUPAC name is S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate.
Molecular Properties
| Compound Name | S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate |
| PubChem CID | 165360435 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)SCc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-3-14(4-2)12(16)17-8-9-5-6-10(13)11(15)7-9/h5-7,15H,3-4,8H2,1-2H3 |
| InChIKey | YOCBRXSKVRGSPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate?
The IUPAC name of S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate (CID 165360435) is S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate.
What is the SMILES notation for S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate?
The canonical SMILES for S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate is CCN(CC)C(=O)SCc1ccc(Cl)c(O)c1.
What is the InChIKey of S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate?
The InChIKey is YOCBRXSKVRGSPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO2S/c1-3-14(4-2)12(16)17-8-9-5-6-10(13)11(15)7-9/h5-7,15H,3-4,8H2,1-2H3.
What are the key properties of S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate?
S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate has a molecular weight of 273.78 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(4-chloro-3-hydroxyphenyl)methyl] N,N-diethylcarbamothioate is sourced from PubChem (CID 165360435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).