C22H21Br3Cl2F2O4 — CID 175361678
2-bromo-1-(bromomethyl)-4-chloro-3-fluorobenzene;diethyl 2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-2-methylpropanedioate (PubChem CID 175361678) has the molecular formula C22H21Br3Cl2F2O4 and a molecular weight of 698.02 g/mol. Its IUPAC name is 2-bromo-1-(bromomethyl)-4-chloro-3-fluorobenzene;diethyl 2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-2-methylpropanedioate.
| Compound Name | 2-bromo-1-(bromomethyl)-4-chloro-3-fluorobenzene;diethyl 2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 175361678 |
| Molecular Formula | C22H21Br3Cl2F2O4 |
| Molecular Weight | 698.02 g/mol |
| Exact Mass | 693.83 |
| IUPAC Name | 2-bromo-1-(bromomethyl)-4-chloro-3-fluorobenzene;diethyl 2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(Cl)c(F)c1Br)C(=O)OCC.Fc1c(Cl)ccc(CBr)c1Br |
| InChI | InChI=1S/C15H17BrClFO4.C7H4Br2ClF/c1-4-21-13(19)15(3,14(20)22-5-2)8-9-6-7-10(17)12(18)11(9)16;8-3-4-1-2-5(10)7(11)6(4)9/h6-7H,4-5,8H2,1-3H3;1-2H,3H2 |
| InChIKey | YHUYYCZFAAJYLP-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.02 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|