C10H9BrClFO2 — CID 117476290
3-(2-bromo-4-chloro-3-fluorophenyl)-2-methylpropanoic acid (PubChem CID 117476290) has the molecular formula C10H9BrClFO2 and a molecular weight of 295.54 g/mol. Its IUPAC name is 3-(2-bromo-4-chloro-3-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | 3-(2-bromo-4-chloro-3-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117476290 |
| Molecular Formula | C10H9BrClFO2 |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 3-(2-bromo-4-chloro-3-fluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(Cl)c(F)c1Br)C(=O)O |
| InChI | InChI=1S/C10H9BrClFO2/c1-5(10(14)15)4-6-2-3-7(12)9(13)8(6)11/h2-3,5H,4H2,1H3,(H,14,15) |
| InChIKey | YRKORLNWWOQUKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|