C10H10ClFO2 — CID 83402731
3-(5-chloro-2-fluorophenyl)-2-methylpropanoic acid (PubChem CID 83402731) has the molecular formula C10H10ClFO2 and a molecular weight of 216.64 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83402731 |
| Molecular Formula | C10H10ClFO2 |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cc(Cl)ccc1F)C(=O)O |
| InChI | InChI=1S/C10H10ClFO2/c1-6(10(13)14)4-7-5-8(11)2-3-9(7)12/h2-3,5-6H,4H2,1H3,(H,13,14) |
| InChIKey | DTLWTLDUXDAJBT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |