3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid

C13H16F2O2 — CID 117357572

IUPAC3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid
SMILESCC(Cc1cc(C(C)C)c(F)cc1F)C(=O)O
InChIInChI=1S/C13H16F2O2/c1-7(2)10-5-9(4-8(3)13(16)17)11(14)6-12(10)15/h5-8H,4H2,1-3H3,(H,16,17)
InChIKeyJTRMCAHZCUAIPV-UHFFFAOYSA-N
MW242.26 g/mol
LogP3.35
Rot. Bonds4

About 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid

3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid (PubChem CID 117357572) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid
PubChem CID117357572
Molecular FormulaC13H16F2O2
Molecular Weight242.26 g/mol
Exact Mass242.11
IUPAC Name3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid
SMILESCC(Cc1cc(C(C)C)c(F)cc1F)C(=O)O
InChIInChI=1S/C13H16F2O2/c1-7(2)10-5-9(4-8(3)13(16)17)11(14)6-12(10)15/h5-8H,4H2,1-3H3,(H,16,17)
InChIKeyJTRMCAHZCUAIPV-UHFFFAOYSA-N
XLogP3.35
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.26
LogP ≤ 53.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid?
The IUPAC name of 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid (CID 117357572) is 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid?
The canonical SMILES for 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid is CC(Cc1cc(C(C)C)c(F)cc1F)C(=O)O.
What is the InChIKey of 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid?
The InChIKey is JTRMCAHZCUAIPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2O2/c1-7(2)10-5-9(4-8(3)13(16)17)11(14)6-12(10)15/h5-8H,4H2,1-3H3,(H,16,17).
What are the key properties of 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid?
3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid has a molecular weight of 242.26 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluoro-5-propan-2-ylphenyl)-2-methylpropanoic acid is sourced from PubChem (CID 117357572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).