C13H14F3NO3 — CID 122111592
2-methyl-3-[methyl-[2-(2,4,5-trifluorophenyl)acetyl]amino]propanoic acid (PubChem CID 122111592) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[2-(2,4,5-trifluorophenyl)acetyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[2-(2,4,5-trifluorophenyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122111592 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-methyl-3-[methyl-[2-(2,4,5-trifluorophenyl)acetyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)Cc1cc(F)c(F)cc1F)C(=O)O |
| InChI | InChI=1S/C13H14F3NO3/c1-7(13(19)20)6-17(2)12(18)4-8-3-10(15)11(16)5-9(8)14/h3,5,7H,4,6H2,1-2H3,(H,19,20) |
| InChIKey | VUQAMKULTZUQDF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|