C16H20FNO4 — CID 122111701
3-[[4-(3-fluorophenyl)-3-methyl-4-oxobutanoyl]-methylamino]-2-methylpropanoic acid (PubChem CID 122111701) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[[4-(3-fluorophenyl)-3-methyl-4-oxobutanoyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[4-(3-fluorophenyl)-3-methyl-4-oxobutanoyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122111701 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-[[4-(3-fluorophenyl)-3-methyl-4-oxobutanoyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)CC(C)C(=O)c1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C16H20FNO4/c1-10(15(20)12-5-4-6-13(17)8-12)7-14(19)18(3)9-11(2)16(21)22/h4-6,8,10-11H,7,9H2,1-3H3,(H,21,22) |
| InChIKey | CHSZODMOTKAHJA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |