C12H11F4NO3 — CID 119228036
2-methyl-3-[methyl-(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid (PubChem CID 119228036) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119228036 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-methyl-3-[methyl-(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)c1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H11F4NO3/c1-5(12(19)20)4-17(2)11(18)8-9(15)6(13)3-7(14)10(8)16/h3,5H,4H2,1-2H3,(H,19,20) |
| InChIKey | MEMISOLNKVRXEE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|