C11H13FN2O3 — CID 104785540
3-[(5-fluoropyridine-3-carbonyl)-methylamino]-2-methylpropanoic acid (PubChem CID 104785540) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-[(5-fluoropyridine-3-carbonyl)-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(5-fluoropyridine-3-carbonyl)-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 104785540 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-[(5-fluoropyridine-3-carbonyl)-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)c1cncc(F)c1)C(=O)O |
| InChI | InChI=1S/C11H13FN2O3/c1-7(11(16)17)6-14(2)10(15)8-3-9(12)5-13-4-8/h3-5,7H,6H2,1-2H3,(H,16,17) |
| InChIKey | JDQUNFFHZYFFPU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |