C14H15FN2O3 — CID 119228216
3-[(4-fluoro-1H-indole-2-carbonyl)-methylamino]-2-methylpropanoic acid (PubChem CID 119228216) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-[(4-fluoro-1H-indole-2-carbonyl)-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(4-fluoro-1H-indole-2-carbonyl)-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119228216 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-[(4-fluoro-1H-indole-2-carbonyl)-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)c1cc2c(F)cccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C14H15FN2O3/c1-8(14(19)20)7-17(2)13(18)12-6-9-10(15)4-3-5-11(9)16-12/h3-6,8,16H,7H2,1-2H3,(H,19,20) |
| InChIKey | ZWVCGLAVJWQOEF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |