C17H16FN3O — CID 110852607
4-fluoro-N-methyl-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide (PubChem CID 110852607) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-methyl-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110852607 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-fluoro-N-methyl-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide |
| SMILES | CN(CCc1ccncc1)C(=O)c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C17H16FN3O/c1-21(10-7-12-5-8-19-9-6-12)17(22)16-11-13-14(18)3-2-4-15(13)20-16/h2-6,8-9,11,20H,7,10H2,1H3 |
| InChIKey | FMQPGWCPKACCEQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |