C17H13BrF2N2O — CID 55580692
N-[(5-bromo-2-fluorophenyl)methyl]-4-fluoro-N-methyl-1H-indole-2-carboxamide (PubChem CID 55580692) has the molecular formula C17H13BrF2N2O and a molecular weight of 379.20 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-4-fluoro-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-4-fluoro-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55580692 |
| Molecular Formula | C17H13BrF2N2O |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-4-fluoro-N-methyl-1H-indole-2-carboxamide |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C17H13BrF2N2O/c1-22(9-10-7-11(18)5-6-13(10)19)17(23)16-8-12-14(20)3-2-4-15(12)21-16/h2-8,21H,9H2,1H3 |
| InChIKey | NZROLSXHGUAUST-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |